C20H33NO5Si — CID 11003793
(4aS,8aR)-7-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethoxy-2,2-dimethyl-4-oxo-8,8a-dihydro-3H-chromene-4a-carbonitrile (PubChem CID 11003793) has the molecular formula C20H33NO5Si and a molecular weight of 395.57 g/mol. Its IUPAC name is (4aS,8aR)-7-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethoxy-2,2-dimethyl-4-oxo-8,8a-dihydro-3H-chromene-4a-carbonitrile.
| Compound Name | (4aS,8aR)-7-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethoxy-2,2-dimethyl-4-oxo-8,8a-dihydro-3H-chromene-4a-carbonitrile |
|---|---|
| PubChem CID | 11003793 |
| Molecular Formula | C20H33NO5Si |
| Molecular Weight | 395.57 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | (4aS,8aR)-7-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethoxy-2,2-dimethyl-4-oxo-8,8a-dihydro-3H-chromene-4a-carbonitrile |
| SMILES | COC1(OC)C=C(O[Si](C)(C)C(C)(C)C)C[C@H]2OC(C)(C)CC(=O)[C@]21C#N |
| InChI | InChI=1S/C20H33NO5Si/c1-17(2,3)27(8,9)26-14-10-16-19(13-21,20(11-14,23-6)24-7)15(22)12-18(4,5)25-16/h11,16H,10,12H2,1-9H3/t16-,19-/m1/s1 |
| InChIKey | BUBVVYUUMWPASX-VQIMIIECSA-N |
| XLogP | 3.93 |
| TPSA | 77.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.57 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|