C24H21N3OS — CID 11003886
[2-amino-6-(pyridin-3-ylmethyl)-5,7-dihydro-4H-thieno[2,3-c]pyridin-3-yl]-naphthalen-2-ylmethanone (PubChem CID 11003886) has the molecular formula C24H21N3OS and a molecular weight of 399.52 g/mol. Its IUPAC name is [2-amino-6-(pyridin-3-ylmethyl)-5,7-dihydro-4H-thieno[2,3-c]pyridin-3-yl]-naphthalen-2-ylmethanone.
| Compound Name | [2-amino-6-(pyridin-3-ylmethyl)-5,7-dihydro-4H-thieno[2,3-c]pyridin-3-yl]-naphthalen-2-ylmethanone |
|---|---|
| PubChem CID | 11003886 |
| Molecular Formula | C24H21N3OS |
| Molecular Weight | 399.52 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | [2-amino-6-(pyridin-3-ylmethyl)-5,7-dihydro-4H-thieno[2,3-c]pyridin-3-yl]-naphthalen-2-ylmethanone |
| SMILES | Nc1sc2c(c1C(=O)c1ccc3ccccc3c1)CCN(Cc1cccnc1)C2 |
| InChI | InChI=1S/C24H21N3OS/c25-24-22(23(28)19-8-7-17-5-1-2-6-18(17)12-19)20-9-11-27(15-21(20)29-24)14-16-4-3-10-26-13-16/h1-8,10,12-13H,9,11,14-15,25H2 |
| InChIKey | FOIOQXCTXUWXDB-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.52 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'} |
|---|