C26H24FNO2 — CID 11003921
5-benzyl-7-fluoro-2,2,4-trimethyl-1H-chromeno[3,4-f]quinolin-5-ol (PubChem CID 11003921) has the molecular formula C26H24FNO2 and a molecular weight of 401.48 g/mol. Its IUPAC name is 5-benzyl-7-fluoro-2,2,4-trimethyl-1H-chromeno[3,4-f]quinolin-5-ol.
| Compound Name | 5-benzyl-7-fluoro-2,2,4-trimethyl-1H-chromeno[3,4-f]quinolin-5-ol |
|---|---|
| PubChem CID | 11003921 |
| Molecular Formula | C26H24FNO2 |
| Molecular Weight | 401.48 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | 5-benzyl-7-fluoro-2,2,4-trimethyl-1H-chromeno[3,4-f]quinolin-5-ol |
| SMILES | CC1=CC(C)(C)Nc2ccc3c(c21)C(O)(Cc1ccccc1)Oc1c(F)cccc1-3 |
| InChI | InChI=1S/C26H24FNO2/c1-16-14-25(2,3)28-21-13-12-18-19-10-7-11-20(27)24(19)30-26(29,23(18)22(16)21)15-17-8-5-4-6-9-17/h4-14,28-29H,15H2,1-3H3 |
| InChIKey | JHWXADPMCJOVTA-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.48 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |