C17H22O9S — CID 11003940
[(2R,3R,4S)-4-acetyloxy-5-methoxy-2-[(4-methylphenyl)sulfonyloxymethyl]oxolan-3-yl] acetate (PubChem CID 11003940) has the molecular formula C17H22O9S and a molecular weight of 402.42 g/mol. Its IUPAC name is [(2R,3R,4S)-4-acetyloxy-5-methoxy-2-[(4-methylphenyl)sulfonyloxymethyl]oxolan-3-yl] acetate.
| Compound Name | [(2R,3R,4S)-4-acetyloxy-5-methoxy-2-[(4-methylphenyl)sulfonyloxymethyl]oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 11003940 |
| Molecular Formula | C17H22O9S |
| Molecular Weight | 402.42 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | [(2R,3R,4S)-4-acetyloxy-5-methoxy-2-[(4-methylphenyl)sulfonyloxymethyl]oxolan-3-yl] acetate |
| SMILES | COC1O[C@H](COS(=O)(=O)c2ccc(C)cc2)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C17H22O9S/c1-10-5-7-13(8-6-10)27(20,21)23-9-14-15(24-11(2)18)16(25-12(3)19)17(22-4)26-14/h5-8,14-17H,9H2,1-4H3/t14-,15-,16+,17?/m1/s1 |
| InChIKey | BTSZIVSTTZIUMJ-VPSFDDGASA-N |
| XLogP | 0.94 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.42 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|