C25H26N2O3 — CID 11003946
2-[(10-methoxy-2,2,4-trimethyl-5-prop-2-enyl-1,5-dihydrochromeno[3,4-f]quinolin-9-yl)oxy]acetonitrile (PubChem CID 11003946) has the molecular formula C25H26N2O3 and a molecular weight of 402.49 g/mol. Its IUPAC name is 2-[(10-methoxy-2,2,4-trimethyl-5-prop-2-enyl-1,5-dihydrochromeno[3,4-f]quinolin-9-yl)oxy]acetonitrile.
| Compound Name | 2-[(10-methoxy-2,2,4-trimethyl-5-prop-2-enyl-1,5-dihydrochromeno[3,4-f]quinolin-9-yl)oxy]acetonitrile |
|---|---|
| PubChem CID | 11003946 |
| Molecular Formula | C25H26N2O3 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | 2-[(10-methoxy-2,2,4-trimethyl-5-prop-2-enyl-1,5-dihydrochromeno[3,4-f]quinolin-9-yl)oxy]acetonitrile |
| SMILES | C=CCC1Oc2ccc(OCC#N)c(OC)c2-c2ccc3c(c21)C(C)=CC(C)(C)N3 |
| InChI | InChI=1S/C25H26N2O3/c1-6-7-18-22-16(8-9-17-21(22)15(2)14-25(3,4)27-17)23-19(30-18)10-11-20(24(23)28-5)29-13-12-26/h6,8-11,14,18,27H,1,7,13H2,2-5H3 |
| InChIKey | BXRWJRAKHHVCNU-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 63.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|