About (6-chloro-1,3-benzodioxol-5-yl)methyl N-[3-(2-oxo-3H-benzimidazol-1-yl)propyl]carbamate
(6-chloro-1,3-benzodioxol-5-yl)methyl N-[3-(2-oxo-3H-benzimidazol-1-yl)propyl]carbamate (PubChem CID 11003971) has the molecular formula C19H18ClN3O5
and a molecular weight of 403.82 g/mol. Its IUPAC name is (6-chloro-1,3-benzodioxol-5-yl)methyl N-[3-(2-oxo-3H-benzimidazol-1-yl)propyl]carbamate.
Molecular Properties
| Compound Name | (6-chloro-1,3-benzodioxol-5-yl)methyl N-[3-(2-oxo-3H-benzimidazol-1-yl)propyl]carbamate |
| PubChem CID | 11003971 |
| Molecular Formula | C19H18ClN3O5 |
| Molecular Weight | 403.82 g/mol |
| Exact Mass | 403.09 |
| IUPAC Name | (6-chloro-1,3-benzodioxol-5-yl)methyl N-[3-(2-oxo-3H-benzimidazol-1-yl)propyl]carbamate |
| SMILES | O=C(NCCCn1c(=O)[nH]c2ccccc21)OCc1cc2c(cc1Cl)OCO2 |
| InChI | InChI=1S/C19H18ClN3O5/c20-13-9-17-16(27-11-28-17)8-12(13)10-26-19(25)21-6-3-7-23-15-5-2-1-4-14(15)22-18(23)24/h1-2,4-5,8-9H,3,6-7,10-11H2,(H,21,25)(H,22,24) |
| InChIKey | JJXREGYWYMPRSA-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 94.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.82 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (6-chloro-1,3-benzodioxol-5-yl)methyl N-[3-(2-oxo-3H-benzimidazol-1-yl)propyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-chloro-1,3-benzodioxol-5-yl)methyl N-[3-(2-oxo-3H-benzimidazol-1-yl)propyl]carbamate?
The IUPAC name of (6-chloro-1,3-benzodioxol-5-yl)methyl N-[3-(2-oxo-3H-benzimidazol-1-yl)propyl]carbamate (CID 11003971) is (6-chloro-1,3-benzodioxol-5-yl)methyl N-[3-(2-oxo-3H-benzimidazol-1-yl)propyl]carbamate.
What is the SMILES notation for (6-chloro-1,3-benzodioxol-5-yl)methyl N-[3-(2-oxo-3H-benzimidazol-1-yl)propyl]carbamate?
The canonical SMILES for (6-chloro-1,3-benzodioxol-5-yl)methyl N-[3-(2-oxo-3H-benzimidazol-1-yl)propyl]carbamate is O=C(NCCCn1c(=O)[nH]c2ccccc21)OCc1cc2c(cc1Cl)OCO2.
What is the InChIKey of (6-chloro-1,3-benzodioxol-5-yl)methyl N-[3-(2-oxo-3H-benzimidazol-1-yl)propyl]carbamate?
The InChIKey is JJXREGYWYMPRSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18ClN3O5/c20-13-9-17-16(27-11-28-17)8-12(13)10-26-19(25)21-6-3-7-23-15-5-2-1-4-14(15)22-18(23)24/h1-2,4-5,8-9H,3,6-7,10-11H2,(H,21,25)(H,22,24).
What are the key properties of (6-chloro-1,3-benzodioxol-5-yl)methyl N-[3-(2-oxo-3H-benzimidazol-1-yl)propyl]carbamate?
(6-chloro-1,3-benzodioxol-5-yl)methyl N-[3-(2-oxo-3H-benzimidazol-1-yl)propyl]carbamate has a molecular weight of 403.82 g/mol, XLogP of 3.03, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (6-chloro-1,3-benzodioxol-5-yl)methyl N-[3-(2-oxo-3H-benzimidazol-1-yl)propyl]carbamate is sourced from PubChem (CID 11003971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).