C18H36IN5O — CID 110040476
2-[[[(1-butylpiperidin-4-yl)amino]-(2-methylprop-2-enylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 110040476) has the molecular formula C18H36IN5O and a molecular weight of 465.42 g/mol. Its IUPAC name is 2-[[[(1-butylpiperidin-4-yl)amino]-(2-methylprop-2-enylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[[(1-butylpiperidin-4-yl)amino]-(2-methylprop-2-enylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 110040476 |
| Molecular Formula | C18H36IN5O |
| Molecular Weight | 465.42 g/mol |
| Exact Mass | 465.20 |
| IUPAC Name | 2-[[[(1-butylpiperidin-4-yl)amino]-(2-methylprop-2-enylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | C=C(C)CN/C(=N\CC(=O)N(C)C)NC1CCN(CCCC)CC1.I |
| InChI | InChI=1S/C18H35N5O.HI/c1-6-7-10-23-11-8-16(9-12-23)21-18(19-13-15(2)3)20-14-17(24)22(4)5;/h16H,2,6-14H2,1,3-5H3,(H2,19,20,21);1H |
| InChIKey | GELUXIWPUFDJCW-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.42 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|