About [(1S,2R)-2-[diethoxyphosphoryl(difluoro)methyl]cyclohexyl]sulfonylbenzene
[(1S,2R)-2-[diethoxyphosphoryl(difluoro)methyl]cyclohexyl]sulfonylbenzene (PubChem CID 11004127) has the molecular formula C17H25F2O5PS
and a molecular weight of 410.42 g/mol. Its IUPAC name is [(1S,2R)-2-[diethoxyphosphoryl(difluoro)methyl]cyclohexyl]sulfonylbenzene.
Molecular Properties
| Compound Name | [(1S,2R)-2-[diethoxyphosphoryl(difluoro)methyl]cyclohexyl]sulfonylbenzene |
| PubChem CID | 11004127 |
| Molecular Formula | C17H25F2O5PS |
| Molecular Weight | 410.42 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | [(1S,2R)-2-[diethoxyphosphoryl(difluoro)methyl]cyclohexyl]sulfonylbenzene |
| SMILES | CCOP(=O)(OCC)C(F)(F)[C@H]1CCCC[C@@H]1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C17H25F2O5PS/c1-3-23-25(20,24-4-2)17(18,19)15-12-8-9-13-16(15)26(21,22)14-10-6-5-7-11-14/h5-7,10-11,15-16H,3-4,8-9,12-13H2,1-2H3/t15-,16-/m0/s1 |
| InChIKey | ACUVQHXCXYEFRK-HOTGVXAUSA-N |
| XLogP | 4.88 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.42 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [(1S,2R)-2-[diethoxyphosphoryl(difluoro)methyl]cyclohexyl]sulfonylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,2R)-2-[diethoxyphosphoryl(difluoro)methyl]cyclohexyl]sulfonylbenzene?
The IUPAC name of [(1S,2R)-2-[diethoxyphosphoryl(difluoro)methyl]cyclohexyl]sulfonylbenzene (CID 11004127) is [(1S,2R)-2-[diethoxyphosphoryl(difluoro)methyl]cyclohexyl]sulfonylbenzene.
What is the SMILES notation for [(1S,2R)-2-[diethoxyphosphoryl(difluoro)methyl]cyclohexyl]sulfonylbenzene?
The canonical SMILES for [(1S,2R)-2-[diethoxyphosphoryl(difluoro)methyl]cyclohexyl]sulfonylbenzene is CCOP(=O)(OCC)C(F)(F)[C@H]1CCCC[C@@H]1S(=O)(=O)c1ccccc1.
What is the InChIKey of [(1S,2R)-2-[diethoxyphosphoryl(difluoro)methyl]cyclohexyl]sulfonylbenzene?
The InChIKey is ACUVQHXCXYEFRK-HOTGVXAUSA-N. The full InChI is InChI=1S/C17H25F2O5PS/c1-3-23-25(20,24-4-2)17(18,19)15-12-8-9-13-16(15)26(21,22)14-10-6-5-7-11-14/h5-7,10-11,15-16H,3-4,8-9,12-13H2,1-2H3/t15-,16-/m0/s1.
What are the key properties of [(1S,2R)-2-[diethoxyphosphoryl(difluoro)methyl]cyclohexyl]sulfonylbenzene?
[(1S,2R)-2-[diethoxyphosphoryl(difluoro)methyl]cyclohexyl]sulfonylbenzene has a molecular weight of 410.42 g/mol, XLogP of 4.88, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,2R)-2-[diethoxyphosphoryl(difluoro)methyl]cyclohexyl]sulfonylbenzene is sourced from PubChem (CID 11004127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).