C19H30N4O2 — CID 110043665
N,N-dimethyl-2-[[[2-(2-methylphenyl)morpholin-4-yl]-(propylamino)methylidene]amino]acetamide (PubChem CID 110043665) has the molecular formula C19H30N4O2 and a molecular weight of 346.48 g/mol. Its IUPAC name is N,N-dimethyl-2-[[[2-(2-methylphenyl)morpholin-4-yl]-(propylamino)methylidene]amino]acetamide.
| Compound Name | N,N-dimethyl-2-[[[2-(2-methylphenyl)morpholin-4-yl]-(propylamino)methylidene]amino]acetamide |
|---|---|
| PubChem CID | 110043665 |
| Molecular Formula | C19H30N4O2 |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.24 |
| IUPAC Name | N,N-dimethyl-2-[[[2-(2-methylphenyl)morpholin-4-yl]-(propylamino)methylidene]amino]acetamide |
| SMILES | CCCN/C(=N\CC(=O)N(C)C)N1CCOC(c2ccccc2C)C1 |
| InChI | InChI=1S/C19H30N4O2/c1-5-10-20-19(21-13-18(24)22(3)4)23-11-12-25-17(14-23)16-9-7-6-8-15(16)2/h6-9,17H,5,10-14H2,1-4H3,(H,20,21) |
| InChIKey | SDBHJVOIXUFTNY-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|