C20H17N5O2S2 — CID 11004386
5-[[(5-methyl-1,3,4-thiadiazol-2-yl)amino]methyl]-1,3-diphenyl-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 11004386) has the molecular formula C20H17N5O2S2 and a molecular weight of 423.52 g/mol. Its IUPAC name is 5-[[(5-methyl-1,3,4-thiadiazol-2-yl)amino]methyl]-1,3-diphenyl-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-[[(5-methyl-1,3,4-thiadiazol-2-yl)amino]methyl]-1,3-diphenyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 11004386 |
| Molecular Formula | C20H17N5O2S2 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.08 |
| IUPAC Name | 5-[[(5-methyl-1,3,4-thiadiazol-2-yl)amino]methyl]-1,3-diphenyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | Cc1nnc(NCC2C(=O)N(c3ccccc3)C(=S)N(c3ccccc3)C2=O)s1 |
| InChI | InChI=1S/C20H17N5O2S2/c1-13-22-23-19(29-13)21-12-16-17(26)24(14-8-4-2-5-9-14)20(28)25(18(16)27)15-10-6-3-7-11-15/h2-11,16H,12H2,1H3,(H,21,23) |
| InChIKey | PAWCAVWWZJFRKJ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|