C16H31IN4O3 — CID 110044716
N,N-dimethyl-2-[[(2-methylprop-2-enylamino)-[1-(oxolan-3-yloxy)propan-2-ylamino]methylidene]amino]acetamide;hydroiodide (PubChem CID 110044716) has the molecular formula C16H31IN4O3 and a molecular weight of 454.35 g/mol. Its IUPAC name is N,N-dimethyl-2-[[(2-methylprop-2-enylamino)-[1-(oxolan-3-yloxy)propan-2-ylamino]methylidene]amino]acetamide;hydroiodide.
| Compound Name | N,N-dimethyl-2-[[(2-methylprop-2-enylamino)-[1-(oxolan-3-yloxy)propan-2-ylamino]methylidene]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 110044716 |
| Molecular Formula | C16H31IN4O3 |
| Molecular Weight | 454.35 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | N,N-dimethyl-2-[[(2-methylprop-2-enylamino)-[1-(oxolan-3-yloxy)propan-2-ylamino]methylidene]amino]acetamide;hydroiodide |
| SMILES | C=C(C)CN/C(=N\CC(=O)N(C)C)NC(C)COC1CCOC1.I |
| InChI | InChI=1S/C16H30N4O3.HI/c1-12(2)8-17-16(18-9-15(21)20(4)5)19-13(3)10-23-14-6-7-22-11-14;/h13-14H,1,6-11H2,2-5H3,(H2,17,18,19);1H |
| InChIKey | QURDOABIMRQMQZ-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.35 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|