C20H25F3N4O2S — CID 110045193
N,N-dimethyl-2-[[N'-[[4-methyl-2-(2,2,2-trifluoroethoxy)phenyl]methyl]-N-(thiophen-2-ylmethyl)carbamimidoyl]amino]acetamide (PubChem CID 110045193) has the molecular formula C20H25F3N4O2S and a molecular weight of 442.51 g/mol. Its IUPAC name is N,N-dimethyl-2-[[N'-[[4-methyl-2-(2,2,2-trifluoroethoxy)phenyl]methyl]-N-(thiophen-2-ylmethyl)carbamimidoyl]amino]acetamide.
| Compound Name | N,N-dimethyl-2-[[N'-[[4-methyl-2-(2,2,2-trifluoroethoxy)phenyl]methyl]-N-(thiophen-2-ylmethyl)carbamimidoyl]amino]acetamide |
|---|---|
| PubChem CID | 110045193 |
| Molecular Formula | C20H25F3N4O2S |
| Molecular Weight | 442.51 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | N,N-dimethyl-2-[[N'-[[4-methyl-2-(2,2,2-trifluoroethoxy)phenyl]methyl]-N-(thiophen-2-ylmethyl)carbamimidoyl]amino]acetamide |
| SMILES | Cc1ccc(C/N=C(\NCC(=O)N(C)C)NCc2cccs2)c(OCC(F)(F)F)c1 |
| InChI | InChI=1S/C20H25F3N4O2S/c1-14-6-7-15(17(9-14)29-13-20(21,22)23)10-24-19(26-12-18(28)27(2)3)25-11-16-5-4-8-30-16/h4-9H,10-13H2,1-3H3,(H2,24,25,26) |
| InChIKey | KLTSDZUYATYTBH-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.51 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|