C23H38N4O3 — CID 110045383
2-[[N'-[[2-(2-methoxyethoxy)-4-methylphenyl]methyl]-N-(2-methylcyclohexyl)carbamimidoyl]amino]-N,N-dimethylacetamide (PubChem CID 110045383) has the molecular formula C23H38N4O3 and a molecular weight of 418.58 g/mol. Its IUPAC name is 2-[[N'-[[2-(2-methoxyethoxy)-4-methylphenyl]methyl]-N-(2-methylcyclohexyl)carbamimidoyl]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[N'-[[2-(2-methoxyethoxy)-4-methylphenyl]methyl]-N-(2-methylcyclohexyl)carbamimidoyl]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 110045383 |
| Molecular Formula | C23H38N4O3 |
| Molecular Weight | 418.58 g/mol |
| Exact Mass | 418.29 |
| IUPAC Name | 2-[[N'-[[2-(2-methoxyethoxy)-4-methylphenyl]methyl]-N-(2-methylcyclohexyl)carbamimidoyl]amino]-N,N-dimethylacetamide |
| SMILES | COCCOc1cc(C)ccc1C/N=C(\NCC(=O)N(C)C)NC1CCCCC1C |
| InChI | InChI=1S/C23H38N4O3/c1-17-10-11-19(21(14-17)30-13-12-29-5)15-24-23(25-16-22(28)27(3)4)26-20-9-7-6-8-18(20)2/h10-11,14,18,20H,6-9,12-13,15-16H2,1-5H3,(H2,24,25,26) |
| InChIKey | KYFYWHRROZDVMB-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.58 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|