C27H40N2O3 — CID 11004704
(E)-N-[(1R,2S,4R,6R,7S,10S,11R,16R)-7,11-dimethyl-6-[(1S)-1-(methylamino)ethyl]-15-oxo-5-oxapentacyclo[8.8.0.02,7.04,6.011,16]octadec-13-en-14-yl]-2-methylbut-2-enamide (PubChem CID 11004704) has the molecular formula C27H40N2O3 and a molecular weight of 440.63 g/mol. Its IUPAC name is (E)-N-[(1R,2S,4R,6R,7S,10S,11R,16R)-7,11-dimethyl-6-[(1S)-1-(methylamino)ethyl]-15-oxo-5-oxapentacyclo[8.8.0.02,7.04,6.011,16]octadec-13-en-14-yl]-2-methylbut-2-enamide.
| Compound Name | (E)-N-[(1R,2S,4R,6R,7S,10S,11R,16R)-7,11-dimethyl-6-[(1S)-1-(methylamino)ethyl]-15-oxo-5-oxapentacyclo[8.8.0.02,7.04,6.011,16]octadec-13-en-14-yl]-2-methylbut-2-enamide |
|---|---|
| PubChem CID | 11004704 |
| Molecular Formula | C27H40N2O3 |
| Molecular Weight | 440.63 g/mol |
| Exact Mass | 440.30 |
| IUPAC Name | (E)-N-[(1R,2S,4R,6R,7S,10S,11R,16R)-7,11-dimethyl-6-[(1S)-1-(methylamino)ethyl]-15-oxo-5-oxapentacyclo[8.8.0.02,7.04,6.011,16]octadec-13-en-14-yl]-2-methylbut-2-enamide |
| SMILES | C/C=C(\C)C(=O)NC1=CC[C@@]2(C)[C@@H](CC[C@@H]3[C@@H]2CC[C@@]2(C)[C@H]3C[C@H]3O[C@]32[C@H](C)NC)C1=O |
| InChI | InChI=1S/C27H40N2O3/c1-7-15(2)24(31)29-21-11-12-25(4)18-10-13-26(5)20(17(18)8-9-19(25)23(21)30)14-22-27(26,32-22)16(3)28-6/h7,11,16-20,22,28H,8-10,12-14H2,1-6H3,(H,29,31)/b15-7+/t16-,17+,18-,19-,20-,22+,25+,26-,27+/m0/s1 |
| InChIKey | LVAFERHGCLNOLQ-RPOKZLQZSA-N |
| XLogP | 4.14 |
| TPSA | 70.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.63 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|