C17H31N5O2S — CID 110047862
2-[[(3-ethoxypropylamino)-[(4-propan-2-yl-1,3-thiazol-2-yl)methylamino]methylidene]amino]-N,N-dimethylacetamide (PubChem CID 110047862) has the molecular formula C17H31N5O2S and a molecular weight of 369.54 g/mol. Its IUPAC name is 2-[[(3-ethoxypropylamino)-[(4-propan-2-yl-1,3-thiazol-2-yl)methylamino]methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[(3-ethoxypropylamino)-[(4-propan-2-yl-1,3-thiazol-2-yl)methylamino]methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 110047862 |
| Molecular Formula | C17H31N5O2S |
| Molecular Weight | 369.54 g/mol |
| Exact Mass | 369.22 |
| IUPAC Name | 2-[[(3-ethoxypropylamino)-[(4-propan-2-yl-1,3-thiazol-2-yl)methylamino]methylidene]amino]-N,N-dimethylacetamide |
| SMILES | CCOCCCN/C(=N\CC(=O)N(C)C)NCc1nc(C(C)C)cs1 |
| InChI | InChI=1S/C17H31N5O2S/c1-6-24-9-7-8-18-17(20-11-16(23)22(4)5)19-10-15-21-14(12-25-15)13(2)3/h12-13H,6-11H2,1-5H3,(H2,18,19,20) |
| InChIKey | JAQWRAXHLTUXLH-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.54 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|