C24H41BN2O5 — CID 11004835
tert-butyl N-[(2S)-3-methyl-1-oxo-1-[(2R)-2-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]pyrrolidin-1-yl]butan-2-yl]carbamate (PubChem CID 11004835) has the molecular formula C24H41BN2O5 and a molecular weight of 448.41 g/mol. Its IUPAC name is tert-butyl N-[(2S)-3-methyl-1-oxo-1-[(2R)-2-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]pyrrolidin-1-yl]butan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-3-methyl-1-oxo-1-[(2R)-2-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]pyrrolidin-1-yl]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 11004835 |
| Molecular Formula | C24H41BN2O5 |
| Molecular Weight | 448.41 g/mol |
| Exact Mass | 448.31 |
| IUPAC Name | tert-butyl N-[(2S)-3-methyl-1-oxo-1-[(2R)-2-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]pyrrolidin-1-yl]butan-2-yl]carbamate |
| SMILES | CC(C)[C@H](NC(=O)OC(C)(C)C)C(=O)N1CCC[C@H]1B1O[C@@H]2C[C@@H]3C[C@@H](C3(C)C)[C@]2(C)O1 |
| InChI | InChI=1S/C24H41BN2O5/c1-14(2)19(26-21(29)30-22(3,4)5)20(28)27-11-9-10-18(27)25-31-17-13-15-12-16(23(15,6)7)24(17,8)32-25/h14-19H,9-13H2,1-8H3,(H,26,29)/t15-,16-,17+,18-,19-,24-/m0/s1 |
| InChIKey | GEBWAJNTTBAAGK-GVJYWCCQSA-N |
| XLogP | 3.79 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.41 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|