C27H38O4S — CID 11005010
(1R,4S,5S,8R,9R,12R)-5,9-dimethyl-4-[2-(oxan-2-yloxy)ethyl]-9-(phenylsulfanylmethyl)-2-oxatricyclo[6.3.1.04,12]dodecan-3-one (PubChem CID 11005010) has the molecular formula C27H38O4S and a molecular weight of 458.66 g/mol. Its IUPAC name is (1R,4S,5S,8R,9R,12R)-5,9-dimethyl-4-[2-(oxan-2-yloxy)ethyl]-9-(phenylsulfanylmethyl)-2-oxatricyclo[6.3.1.04,12]dodecan-3-one.
| Compound Name | (1R,4S,5S,8R,9R,12R)-5,9-dimethyl-4-[2-(oxan-2-yloxy)ethyl]-9-(phenylsulfanylmethyl)-2-oxatricyclo[6.3.1.04,12]dodecan-3-one |
|---|---|
| PubChem CID | 11005010 |
| Molecular Formula | C27H38O4S |
| Molecular Weight | 458.66 g/mol |
| Exact Mass | 458.25 |
| IUPAC Name | (1R,4S,5S,8R,9R,12R)-5,9-dimethyl-4-[2-(oxan-2-yloxy)ethyl]-9-(phenylsulfanylmethyl)-2-oxatricyclo[6.3.1.04,12]dodecan-3-one |
| SMILES | C[C@H]1CC[C@@H]2[C@H]3[C@@H](CC[C@@]2(C)CSc2ccccc2)OC(=O)[C@]31CCOC1CCCCO1 |
| InChI | InChI=1S/C27H38O4S/c1-19-11-12-21-24-22(13-14-26(21,2)18-32-20-8-4-3-5-9-20)31-25(28)27(19,24)15-17-30-23-10-6-7-16-29-23/h3-5,8-9,19,21-24H,6-7,10-18H2,1-2H3/t19-,21+,22+,23?,24-,26-,27-/m0/s1 |
| InChIKey | OYRUUQASJHILHK-HWVBQARUSA-N |
| XLogP | 6.09 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.66 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |