C17H27N3O — CID 110050348
2-(2,3-dihydro-1-benzofuran-3-yl)-1-(6-methylheptan-2-yl)guanidine (PubChem CID 110050348) has the molecular formula C17H27N3O and a molecular weight of 289.42 g/mol. Its IUPAC name is 2-(2,3-dihydro-1-benzofuran-3-yl)-1-(6-methylheptan-2-yl)guanidine.
| Compound Name | 2-(2,3-dihydro-1-benzofuran-3-yl)-1-(6-methylheptan-2-yl)guanidine |
|---|---|
| PubChem CID | 110050348 |
| Molecular Formula | C17H27N3O |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.22 |
| IUPAC Name | 2-(2,3-dihydro-1-benzofuran-3-yl)-1-(6-methylheptan-2-yl)guanidine |
| SMILES | CC(C)CCCC(C)N/C(N)=N/C1COc2ccccc21 |
| InChI | InChI=1S/C17H27N3O/c1-12(2)7-6-8-13(3)19-17(18)20-15-11-21-16-10-5-4-9-14(15)16/h4-5,9-10,12-13,15H,6-8,11H2,1-3H3,(H3,18,19,20) |
| InChIKey | QMKPAUWROMTNRY-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|