C22H31N3O3 — CID 110051032
1-[2-(furan-2-yl)ethyl]-2-[(4-methoxyphenyl)methyl]-3-[2-(oxan-2-yl)ethyl]guanidine (PubChem CID 110051032) has the molecular formula C22H31N3O3 and a molecular weight of 385.51 g/mol. Its IUPAC name is 1-[2-(furan-2-yl)ethyl]-2-[(4-methoxyphenyl)methyl]-3-[2-(oxan-2-yl)ethyl]guanidine.
| Compound Name | 1-[2-(furan-2-yl)ethyl]-2-[(4-methoxyphenyl)methyl]-3-[2-(oxan-2-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 110051032 |
| Molecular Formula | C22H31N3O3 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.24 |
| IUPAC Name | 1-[2-(furan-2-yl)ethyl]-2-[(4-methoxyphenyl)methyl]-3-[2-(oxan-2-yl)ethyl]guanidine |
| SMILES | COc1ccc(C/N=C(/NCCc2ccco2)NCCC2CCCCO2)cc1 |
| InChI | InChI=1S/C22H31N3O3/c1-26-19-9-7-18(8-10-19)17-25-22(24-14-12-21-6-4-16-28-21)23-13-11-20-5-2-3-15-27-20/h4,6-10,16,20H,2-3,5,11-15,17H2,1H3,(H2,23,24,25) |
| InChIKey | HRGKDKBOVGBWIH-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|