C23H23N3O4 — CID 1100515
4-nitro-N-[(2E,4E)-1-oxo-5-phenyl-1-piperidin-1-ylpenta-2,4-dien-2-yl]benzamide (PubChem CID 1100515) has the molecular formula C23H23N3O4 and a molecular weight of 405.45 g/mol. Its IUPAC name is 4-nitro-N-[(2E,4E)-1-oxo-5-phenyl-1-piperidin-1-ylpenta-2,4-dien-2-yl]benzamide.
| Compound Name | 4-nitro-N-[(2E,4E)-1-oxo-5-phenyl-1-piperidin-1-ylpenta-2,4-dien-2-yl]benzamide |
|---|---|
| PubChem CID | 1100515 |
| Molecular Formula | C23H23N3O4 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | 4-nitro-N-[(2E,4E)-1-oxo-5-phenyl-1-piperidin-1-ylpenta-2,4-dien-2-yl]benzamide |
| SMILES | O=C(N/C(=C/C=C/c1ccccc1)C(=O)N1CCCCC1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H23N3O4/c27-22(19-12-14-20(15-13-19)26(29)30)24-21(23(28)25-16-5-2-6-17-25)11-7-10-18-8-3-1-4-9-18/h1,3-4,7-15H,2,5-6,16-17H2,(H,24,27)/b10-7+,21-11+ |
| InChIKey | RZFODZWMXIGJKS-WDECGGBJSA-N |
| XLogP | 3.93 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|