C30H50O4 — CID 11005259
2-[(2E,5E,9E)-6,10,14-trimethyl-2-[2-(oxan-2-yloxy)ethylidene]pentadeca-5,9,13-trienoxy]oxane (PubChem CID 11005259) has the molecular formula C30H50O4 and a molecular weight of 474.73 g/mol. Its IUPAC name is 2-[(2E,5E,9E)-6,10,14-trimethyl-2-[2-(oxan-2-yloxy)ethylidene]pentadeca-5,9,13-trienoxy]oxane.
| Compound Name | 2-[(2E,5E,9E)-6,10,14-trimethyl-2-[2-(oxan-2-yloxy)ethylidene]pentadeca-5,9,13-trienoxy]oxane |
|---|---|
| PubChem CID | 11005259 |
| Molecular Formula | C30H50O4 |
| Molecular Weight | 474.73 g/mol |
| Exact Mass | 474.37 |
| IUPAC Name | 2-[(2E,5E,9E)-6,10,14-trimethyl-2-[2-(oxan-2-yloxy)ethylidene]pentadeca-5,9,13-trienoxy]oxane |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C(=C\COC1CCCCO1)COC1CCCCO1 |
| InChI | InChI=1S/C30H50O4/c1-25(2)12-9-13-26(3)14-10-15-27(4)16-11-17-28(24-34-30-19-6-8-22-32-30)20-23-33-29-18-5-7-21-31-29/h12,14,16,20,29-30H,5-11,13,15,17-19,21-24H2,1-4H3/b26-14+,27-16+,28-20+ |
| InChIKey | ZLCBBXMNVIJDDM-YHVVAEAJSA-N |
| XLogP | 8.20 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.73 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|