C31H44O2Si — CID 11005297
tert-butyl-[(2E,6E)-9-(3,3-dimethyloxiran-2-yl)-3,7-dimethylnona-2,6-dienoxy]-diphenylsilane (PubChem CID 11005297) has the molecular formula C31H44O2Si and a molecular weight of 476.78 g/mol. Its IUPAC name is tert-butyl-[(2E,6E)-9-(3,3-dimethyloxiran-2-yl)-3,7-dimethylnona-2,6-dienoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(2E,6E)-9-(3,3-dimethyloxiran-2-yl)-3,7-dimethylnona-2,6-dienoxy]-diphenylsilane |
|---|---|
| PubChem CID | 11005297 |
| Molecular Formula | C31H44O2Si |
| Molecular Weight | 476.78 g/mol |
| Exact Mass | 476.31 |
| IUPAC Name | tert-butyl-[(2E,6E)-9-(3,3-dimethyloxiran-2-yl)-3,7-dimethylnona-2,6-dienoxy]-diphenylsilane |
| SMILES | C/C(=C\CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)CC/C=C(\C)CCC1OC1(C)C |
| InChI | InChI=1S/C31H44O2Si/c1-25(21-22-29-31(6,7)33-29)15-14-16-26(2)23-24-32-34(30(3,4)5,27-17-10-8-11-18-27)28-19-12-9-13-20-28/h8-13,15,17-20,23,29H,14,16,21-22,24H2,1-7H3/b25-15+,26-23+ |
| InChIKey | KQEXMFOSKFALHR-PZGDPEPUSA-N |
| XLogP | 7.19 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.78 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|