C16H30IN3O — CID 110053337
3-butan-2-yl-1-butyl-2-[2-(furan-2-yl)ethyl]-1-methylguanidine;hydroiodide (PubChem CID 110053337) has the molecular formula C16H30IN3O and a molecular weight of 407.34 g/mol. Its IUPAC name is 3-butan-2-yl-1-butyl-2-[2-(furan-2-yl)ethyl]-1-methylguanidine;hydroiodide.
| Compound Name | 3-butan-2-yl-1-butyl-2-[2-(furan-2-yl)ethyl]-1-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110053337 |
| Molecular Formula | C16H30IN3O |
| Molecular Weight | 407.34 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | 3-butan-2-yl-1-butyl-2-[2-(furan-2-yl)ethyl]-1-methylguanidine;hydroiodide |
| SMILES | CCCCN(C)/C(=N\CCc1ccco1)NC(C)CC.I |
| InChI | InChI=1S/C16H29N3O.HI/c1-5-7-12-19(4)16(18-14(3)6-2)17-11-10-15-9-8-13-20-15;/h8-9,13-14H,5-7,10-12H2,1-4H3,(H,17,18);1H |
| InChIKey | TYKDDYWPUUOKKV-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 40.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.34 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|