C18H26IN3OS — CID 110053723
3-cyclopentyl-2-[2-(furan-2-yl)ethyl]-1-methyl-1-(thiophen-3-ylmethyl)guanidine;hydroiodide (PubChem CID 110053723) has the molecular formula C18H26IN3OS and a molecular weight of 459.40 g/mol. Its IUPAC name is 3-cyclopentyl-2-[2-(furan-2-yl)ethyl]-1-methyl-1-(thiophen-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 3-cyclopentyl-2-[2-(furan-2-yl)ethyl]-1-methyl-1-(thiophen-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110053723 |
| Molecular Formula | C18H26IN3OS |
| Molecular Weight | 459.40 g/mol |
| Exact Mass | 459.08 |
| IUPAC Name | 3-cyclopentyl-2-[2-(furan-2-yl)ethyl]-1-methyl-1-(thiophen-3-ylmethyl)guanidine;hydroiodide |
| SMILES | CN(Cc1ccsc1)/C(=N\CCc1ccco1)NC1CCCC1.I |
| InChI | InChI=1S/C18H25N3OS.HI/c1-21(13-15-9-12-23-14-15)18(20-16-5-2-3-6-16)19-10-8-17-7-4-11-22-17;/h4,7,9,11-12,14,16H,2-3,5-6,8,10,13H2,1H3,(H,19,20);1H |
| InChIKey | NZZITXMVZXKZOB-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 40.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.40 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|