C16H15F3INO3S — CID 11005405
(2-cyano-4,5-dimethylcyclohexa-1,4-dien-1-yl)-phenyliodanium;trifluoromethanesulfonate (PubChem CID 11005405) has the molecular formula C16H15F3INO3S and a molecular weight of 485.27 g/mol. Its IUPAC name is (2-cyano-4,5-dimethylcyclohexa-1,4-dien-1-yl)-phenyliodanium;trifluoromethanesulfonate.
| Compound Name | (2-cyano-4,5-dimethylcyclohexa-1,4-dien-1-yl)-phenyliodanium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 11005405 |
| Molecular Formula | C16H15F3INO3S |
| Molecular Weight | 485.27 g/mol |
| Exact Mass | 484.98 |
| IUPAC Name | (2-cyano-4,5-dimethylcyclohexa-1,4-dien-1-yl)-phenyliodanium;trifluoromethanesulfonate |
| SMILES | CC1=C(C)CC([I+]c2ccccc2)=C(C#N)C1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C15H15IN.CHF3O3S/c1-11-8-13(10-17)15(9-12(11)2)16-14-6-4-3-5-7-14;2-1(3,4)8(5,6)7/h3-7H,8-9H2,1-2H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | GVCKLQHPBIZHCH-UHFFFAOYSA-M |
| XLogP | 0.90 |
| TPSA | 80.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.27 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|