C25H36N4O — CID 110054522
1-(1-cyclopentylpiperidin-4-yl)-2-[2-(furan-2-yl)ethyl]-3-(1-phenylethyl)guanidine (PubChem CID 110054522) has the molecular formula C25H36N4O and a molecular weight of 408.59 g/mol. Its IUPAC name is 1-(1-cyclopentylpiperidin-4-yl)-2-[2-(furan-2-yl)ethyl]-3-(1-phenylethyl)guanidine.
| Compound Name | 1-(1-cyclopentylpiperidin-4-yl)-2-[2-(furan-2-yl)ethyl]-3-(1-phenylethyl)guanidine |
|---|---|
| PubChem CID | 110054522 |
| Molecular Formula | C25H36N4O |
| Molecular Weight | 408.59 g/mol |
| Exact Mass | 408.29 |
| IUPAC Name | 1-(1-cyclopentylpiperidin-4-yl)-2-[2-(furan-2-yl)ethyl]-3-(1-phenylethyl)guanidine |
| SMILES | CC(N/C(=N\CCc1ccco1)NC1CCN(C2CCCC2)CC1)c1ccccc1 |
| InChI | InChI=1S/C25H36N4O/c1-20(21-8-3-2-4-9-21)27-25(26-16-13-24-12-7-19-30-24)28-22-14-17-29(18-15-22)23-10-5-6-11-23/h2-4,7-9,12,19-20,22-23H,5-6,10-11,13-18H2,1H3,(H2,26,27,28) |
| InChIKey | NMPULXWUYPHRSH-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 52.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.59 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|