C23H26F7NO3 — CID 11005564
3,3-dimethyl-1-[(2S)-2-[5-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]pentanoyl]pyrrolidin-1-yl]pentane-1,2-dione (PubChem CID 11005564) has the molecular formula C23H26F7NO3 and a molecular weight of 497.45 g/mol. Its IUPAC name is 3,3-dimethyl-1-[(2S)-2-[5-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]pentanoyl]pyrrolidin-1-yl]pentane-1,2-dione.
| Compound Name | 3,3-dimethyl-1-[(2S)-2-[5-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]pentanoyl]pyrrolidin-1-yl]pentane-1,2-dione |
|---|---|
| PubChem CID | 11005564 |
| Molecular Formula | C23H26F7NO3 |
| Molecular Weight | 497.45 g/mol |
| Exact Mass | 497.18 |
| IUPAC Name | 3,3-dimethyl-1-[(2S)-2-[5-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]pentanoyl]pyrrolidin-1-yl]pentane-1,2-dione |
| SMILES | CCC(C)(C)C(=O)C(=O)N1CCC[C@H]1C(=O)CCCCc1c(F)c(F)c(C(F)(F)F)c(F)c1F |
| InChI | InChI=1S/C23H26F7NO3/c1-4-22(2,3)20(33)21(34)31-11-7-9-13(31)14(32)10-6-5-8-12-16(24)18(26)15(23(28,29)30)19(27)17(12)25/h13H,4-11H2,1-3H3/t13-/m0/s1 |
| InChIKey | VAWIHHCJRBQOLP-ZDUSSCGKSA-N |
| XLogP | 5.54 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.45 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|