C32H39N3O2 — CID 11005571
3-[(R)-[(2S,5R)-2,5-dimethyl-4-prop-2-enylpiperazin-1-yl]-(3-hydroxyphenyl)methyl]-N-phenyl-N-propylbenzamide (PubChem CID 11005571) has the molecular formula C32H39N3O2 and a molecular weight of 497.68 g/mol. Its IUPAC name is 3-[(R)-[(2S,5R)-2,5-dimethyl-4-prop-2-enylpiperazin-1-yl]-(3-hydroxyphenyl)methyl]-N-phenyl-N-propylbenzamide.
| Compound Name | 3-[(R)-[(2S,5R)-2,5-dimethyl-4-prop-2-enylpiperazin-1-yl]-(3-hydroxyphenyl)methyl]-N-phenyl-N-propylbenzamide |
|---|---|
| PubChem CID | 11005571 |
| Molecular Formula | C32H39N3O2 |
| Molecular Weight | 497.68 g/mol |
| Exact Mass | 497.30 |
| IUPAC Name | 3-[(R)-[(2S,5R)-2,5-dimethyl-4-prop-2-enylpiperazin-1-yl]-(3-hydroxyphenyl)methyl]-N-phenyl-N-propylbenzamide |
| SMILES | C=CCN1C[C@H](C)N([C@@H](c2cccc(O)c2)c2cccc(C(=O)N(CCC)c3ccccc3)c2)C[C@H]1C |
| InChI | InChI=1S/C32H39N3O2/c1-5-18-33-22-25(4)35(23-24(33)3)31(27-13-11-17-30(36)21-27)26-12-10-14-28(20-26)32(37)34(19-6-2)29-15-8-7-9-16-29/h5,7-17,20-21,24-25,31,36H,1,6,18-19,22-23H2,2-4H3/t24-,25+,31-/m1/s1 |
| InChIKey | CQDPJHWJALGXFF-UALAUUDGSA-N |
| XLogP | 6.12 |
| TPSA | 47.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.68 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|