C29H42O5S — CID 11005628
[(2E,6E)-5-hydroxy-3,7-dimethyl-9-(4-methylphenyl)sulfonyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,6-dienyl] acetate (PubChem CID 11005628) has the molecular formula C29H42O5S and a molecular weight of 502.72 g/mol. Its IUPAC name is [(2E,6E)-5-hydroxy-3,7-dimethyl-9-(4-methylphenyl)sulfonyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,6-dienyl] acetate.
| Compound Name | [(2E,6E)-5-hydroxy-3,7-dimethyl-9-(4-methylphenyl)sulfonyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,6-dienyl] acetate |
|---|---|
| PubChem CID | 11005628 |
| Molecular Formula | C29H42O5S |
| Molecular Weight | 502.72 g/mol |
| Exact Mass | 502.28 |
| IUPAC Name | [(2E,6E)-5-hydroxy-3,7-dimethyl-9-(4-methylphenyl)sulfonyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,6-dienyl] acetate |
| SMILES | CC(=O)OC/C=C(\C)CC(O)/C=C(\C)CC(C1=C(C)CCCC1(C)C)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C29H42O5S/c1-20-10-12-26(13-11-20)35(32,33)27(28-23(4)9-8-15-29(28,6)7)19-22(3)18-25(31)17-21(2)14-16-34-24(5)30/h10-14,18,25,27,31H,8-9,15-17,19H2,1-7H3/b21-14+,22-18+ |
| InChIKey | LJCPIOMOIZVRSX-SEUYJHDCSA-N |
| XLogP | 6.26 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.72 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|