C21H30F3IN4OS — CID 110056569
3-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]-N-[2-(furan-2-yl)ethyl]-N'-(thiophen-2-ylmethyl)pyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 110056569) has the molecular formula C21H30F3IN4OS and a molecular weight of 570.46 g/mol. Its IUPAC name is 3-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]-N-[2-(furan-2-yl)ethyl]-N'-(thiophen-2-ylmethyl)pyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | 3-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]-N-[2-(furan-2-yl)ethyl]-N'-(thiophen-2-ylmethyl)pyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 110056569 |
| Molecular Formula | C21H30F3IN4OS |
| Molecular Weight | 570.46 g/mol |
| Exact Mass | 570.11 |
| IUPAC Name | 3-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]-N-[2-(furan-2-yl)ethyl]-N'-(thiophen-2-ylmethyl)pyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | CCN(CC1CCN(/C(=N/Cc2cccs2)NCCc2ccco2)C1)CC(F)(F)F.I |
| InChI | InChI=1S/C21H29F3N4OS.HI/c1-2-27(16-21(22,23)24)14-17-8-10-28(15-17)20(26-13-19-6-4-12-30-19)25-9-7-18-5-3-11-29-18;/h3-6,11-12,17H,2,7-10,13-16H2,1H3,(H,25,26);1H |
| InChIKey | CMIRSBDBSYVVBZ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 44.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.46 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|