About 1-tert-butylsulfanyl-5,5-difluoro-4-triphenylsilyloxycyclohex-3-ene-1-carbonitrile
1-tert-butylsulfanyl-5,5-difluoro-4-triphenylsilyloxycyclohex-3-ene-1-carbonitrile (PubChem CID 11005677) has the molecular formula C29H29F2NOSSi
and a molecular weight of 505.71 g/mol. Its IUPAC name is 1-tert-butylsulfanyl-5,5-difluoro-4-triphenylsilyloxycyclohex-3-ene-1-carbonitrile.
Molecular Properties
| Compound Name | 1-tert-butylsulfanyl-5,5-difluoro-4-triphenylsilyloxycyclohex-3-ene-1-carbonitrile |
| PubChem CID | 11005677 |
| Molecular Formula | C29H29F2NOSSi |
| Molecular Weight | 505.71 g/mol |
| Exact Mass | 505.17 |
| IUPAC Name | 1-tert-butylsulfanyl-5,5-difluoro-4-triphenylsilyloxycyclohex-3-ene-1-carbonitrile |
| SMILES | CC(C)(C)SC1(C#N)CC=C(O[Si](c2ccccc2)(c2ccccc2)c2ccccc2)C(F)(F)C1 |
| InChI | InChI=1S/C29H29F2NOSSi/c1-27(2,3)34-28(22-32)20-19-26(29(30,31)21-28)33-35(23-13-7-4-8-14-23,24-15-9-5-10-16-24)25-17-11-6-12-18-25/h4-19H,20-21H2,1-3H3 |
| InChIKey | MLLISTKJYACZLL-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 505.71 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze 1-tert-butylsulfanyl-5,5-difluoro-4-triphenylsilyloxycyclohex-3-ene-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butylsulfanyl-5,5-difluoro-4-triphenylsilyloxycyclohex-3-ene-1-carbonitrile?
The IUPAC name of 1-tert-butylsulfanyl-5,5-difluoro-4-triphenylsilyloxycyclohex-3-ene-1-carbonitrile (CID 11005677) is 1-tert-butylsulfanyl-5,5-difluoro-4-triphenylsilyloxycyclohex-3-ene-1-carbonitrile.
What is the SMILES notation for 1-tert-butylsulfanyl-5,5-difluoro-4-triphenylsilyloxycyclohex-3-ene-1-carbonitrile?
The canonical SMILES for 1-tert-butylsulfanyl-5,5-difluoro-4-triphenylsilyloxycyclohex-3-ene-1-carbonitrile is CC(C)(C)SC1(C#N)CC=C(O[Si](c2ccccc2)(c2ccccc2)c2ccccc2)C(F)(F)C1.
What is the InChIKey of 1-tert-butylsulfanyl-5,5-difluoro-4-triphenylsilyloxycyclohex-3-ene-1-carbonitrile?
The InChIKey is MLLISTKJYACZLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H29F2NOSSi/c1-27(2,3)34-28(22-32)20-19-26(29(30,31)21-28)33-35(23-13-7-4-8-14-23,24-15-9-5-10-16-24)25-17-11-6-12-18-25/h4-19H,20-21H2,1-3H3.
What are the key properties of 1-tert-butylsulfanyl-5,5-difluoro-4-triphenylsilyloxycyclohex-3-ene-1-carbonitrile?
1-tert-butylsulfanyl-5,5-difluoro-4-triphenylsilyloxycyclohex-3-ene-1-carbonitrile has a molecular weight of 505.71 g/mol, XLogP of 5.78, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butylsulfanyl-5,5-difluoro-4-triphenylsilyloxycyclohex-3-ene-1-carbonitrile is sourced from PubChem (CID 11005677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).