C24H37IN4O4 — CID 110057611
1-[2-(furan-2-yl)ethyl]-2-[2-hydroxy-2-(3-propan-2-yloxyphenyl)ethyl]-3-(2-morpholin-4-ylethyl)guanidine;hydroiodide (PubChem CID 110057611) has the molecular formula C24H37IN4O4 and a molecular weight of 572.49 g/mol. Its IUPAC name is 1-[2-(furan-2-yl)ethyl]-2-[2-hydroxy-2-(3-propan-2-yloxyphenyl)ethyl]-3-(2-morpholin-4-ylethyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(furan-2-yl)ethyl]-2-[2-hydroxy-2-(3-propan-2-yloxyphenyl)ethyl]-3-(2-morpholin-4-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110057611 |
| Molecular Formula | C24H37IN4O4 |
| Molecular Weight | 572.49 g/mol |
| Exact Mass | 572.19 |
| IUPAC Name | 1-[2-(furan-2-yl)ethyl]-2-[2-hydroxy-2-(3-propan-2-yloxyphenyl)ethyl]-3-(2-morpholin-4-ylethyl)guanidine;hydroiodide |
| SMILES | CC(C)Oc1cccc(C(O)C/N=C(/NCCc2ccco2)NCCN2CCOCC2)c1.I |
| InChI | InChI=1S/C24H36N4O4.HI/c1-19(2)32-22-6-3-5-20(17-22)23(29)18-27-24(25-9-8-21-7-4-14-31-21)26-10-11-28-12-15-30-16-13-28;/h3-7,14,17,19,23,29H,8-13,15-16,18H2,1-2H3,(H2,25,26,27);1H |
| InChIKey | XTECJOHMDVFWCM-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 91.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.49 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|