C19H29N5O4S — CID 110058104
N-butan-2-yl-N'-[2-(furan-2-yl)ethyl]-4-(1,2-oxazol-3-ylmethylsulfonyl)piperazine-1-carboximidamide (PubChem CID 110058104) has the molecular formula C19H29N5O4S and a molecular weight of 423.54 g/mol. Its IUPAC name is N-butan-2-yl-N'-[2-(furan-2-yl)ethyl]-4-(1,2-oxazol-3-ylmethylsulfonyl)piperazine-1-carboximidamide.
| Compound Name | N-butan-2-yl-N'-[2-(furan-2-yl)ethyl]-4-(1,2-oxazol-3-ylmethylsulfonyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 110058104 |
| Molecular Formula | C19H29N5O4S |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | N-butan-2-yl-N'-[2-(furan-2-yl)ethyl]-4-(1,2-oxazol-3-ylmethylsulfonyl)piperazine-1-carboximidamide |
| SMILES | CCC(C)N/C(=N\CCc1ccco1)N1CCN(S(=O)(=O)Cc2ccon2)CC1 |
| InChI | InChI=1S/C19H29N5O4S/c1-3-16(2)21-19(20-8-6-18-5-4-13-27-18)23-9-11-24(12-10-23)29(25,26)15-17-7-14-28-22-17/h4-5,7,13-14,16H,3,6,8-12,15H2,1-2H3,(H,20,21) |
| InChIKey | RGKZGHHPLADBQP-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 104.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|