C35H38P2 — CID 11005839
[(1R,2R,4R,7R)-1-(diphenylphosphanylmethyl)-2,7-dimethyl-7-bicyclo[2.2.1]heptanyl]methyl-diphenylphosphane (PubChem CID 11005839) has the molecular formula C35H38P2 and a molecular weight of 520.64 g/mol. Its IUPAC name is [(1R,2R,4R,7R)-1-(diphenylphosphanylmethyl)-2,7-dimethyl-7-bicyclo[2.2.1]heptanyl]methyl-diphenylphosphane.
| Compound Name | [(1R,2R,4R,7R)-1-(diphenylphosphanylmethyl)-2,7-dimethyl-7-bicyclo[2.2.1]heptanyl]methyl-diphenylphosphane |
|---|---|
| PubChem CID | 11005839 |
| Molecular Formula | C35H38P2 |
| Molecular Weight | 520.64 g/mol |
| Exact Mass | 520.24 |
| IUPAC Name | [(1R,2R,4R,7R)-1-(diphenylphosphanylmethyl)-2,7-dimethyl-7-bicyclo[2.2.1]heptanyl]methyl-diphenylphosphane |
| SMILES | C[C@@H]1C[C@H]2CC[C@]1(CP(c1ccccc1)c1ccccc1)[C@]2(C)CP(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C35H38P2/c1-28-25-29-23-24-35(28,27-37(32-19-11-5-12-20-32)33-21-13-6-14-22-33)34(29,2)26-36(30-15-7-3-8-16-30)31-17-9-4-10-18-31/h3-22,28-29H,23-27H2,1-2H3/t28-,29-,34-,35-/m1/s1 |
| InChIKey | MJKWESPTLGSHLD-RVOFTLIFSA-N |
| XLogP | 7.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.64 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|