C22H25NO3 — CID 1100585
(3aS,9bR)-5-[(2,4-dimethoxyphenyl)methyl]-8-methoxy-3,3a,4,9b-tetrahydrocyclopenta[c]quinoline (PubChem CID 1100585) has the molecular formula C22H25NO3 and a molecular weight of 351.45 g/mol. Its IUPAC name is (3aS,9bR)-5-[(2,4-dimethoxyphenyl)methyl]-8-methoxy-3,3a,4,9b-tetrahydrocyclopenta[c]quinoline.
| Compound Name | (3aS,9bR)-5-[(2,4-dimethoxyphenyl)methyl]-8-methoxy-3,3a,4,9b-tetrahydrocyclopenta[c]quinoline |
|---|---|
| PubChem CID | 1100585 |
| Molecular Formula | C22H25NO3 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | (3aS,9bR)-5-[(2,4-dimethoxyphenyl)methyl]-8-methoxy-3,3a,4,9b-tetrahydrocyclopenta[c]quinoline |
| SMILES | COc1ccc(CN2C[C@H]3CC=C[C@H]3c3cc(OC)ccc32)c(OC)c1 |
| InChI | InChI=1S/C22H25NO3/c1-24-17-9-10-21-20(11-17)19-6-4-5-15(19)13-23(21)14-16-7-8-18(25-2)12-22(16)26-3/h4,6-12,15,19H,5,13-14H2,1-3H3/t15-,19-/m1/s1 |
| InChIKey | RGXUYAXQNCTOGR-DNVCBOLYSA-N |
| XLogP | 4.39 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|