C20H28IN3OS — CID 110058907
1-[2-(furan-2-yl)ethyl]-3-(1-phenylethyl)-2-(thiolan-2-ylmethyl)guanidine;hydroiodide (PubChem CID 110058907) has the molecular formula C20H28IN3OS and a molecular weight of 485.44 g/mol. Its IUPAC name is 1-[2-(furan-2-yl)ethyl]-3-(1-phenylethyl)-2-(thiolan-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(furan-2-yl)ethyl]-3-(1-phenylethyl)-2-(thiolan-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110058907 |
| Molecular Formula | C20H28IN3OS |
| Molecular Weight | 485.44 g/mol |
| Exact Mass | 485.10 |
| IUPAC Name | 1-[2-(furan-2-yl)ethyl]-3-(1-phenylethyl)-2-(thiolan-2-ylmethyl)guanidine;hydroiodide |
| SMILES | CC(N/C(=N/CC1CCCS1)NCCc1ccco1)c1ccccc1.I |
| InChI | InChI=1S/C20H27N3OS.HI/c1-16(17-7-3-2-4-8-17)23-20(22-15-19-10-6-14-25-19)21-12-11-18-9-5-13-24-18;/h2-5,7-9,13,16,19H,6,10-12,14-15H2,1H3,(H2,21,22,23);1H |
| InChIKey | ACJSLKZKOGSNCI-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 49.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.44 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|