C23H30O14 — CID 11005943
methyl (1R,4S,5S,8R)-3-oxo-8-[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxy-2-oxabicyclo[2.2.2]octane-5-carboxylate (PubChem CID 11005943) has the molecular formula C23H30O14 and a molecular weight of 530.48 g/mol. Its IUPAC name is methyl (1R,4S,5S,8R)-3-oxo-8-[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxy-2-oxabicyclo[2.2.2]octane-5-carboxylate.
| Compound Name | methyl (1R,4S,5S,8R)-3-oxo-8-[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxy-2-oxabicyclo[2.2.2]octane-5-carboxylate |
|---|---|
| PubChem CID | 11005943 |
| Molecular Formula | C23H30O14 |
| Molecular Weight | 530.48 g/mol |
| Exact Mass | 530.16 |
| IUPAC Name | methyl (1R,4S,5S,8R)-3-oxo-8-[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxy-2-oxabicyclo[2.2.2]octane-5-carboxylate |
| SMILES | COC(=O)[C@H]1C[C@@H]2C[C@@H](O[C@@H]3O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]3OC(C)=O)[C@H]1C(=O)O2 |
| InChI | InChI=1S/C23H30O14/c1-9(24)31-8-16-18(32-10(2)25)19(33-11(3)26)20(34-12(4)27)23(37-16)36-15-7-13-6-14(21(28)30-5)17(15)22(29)35-13/h13-20,23H,6-8H2,1-5H3/t13-,14+,15-,16-,17+,18-,19+,20-,23-/m1/s1 |
| InChIKey | CVMQJCMDSJHDNZ-PMOZWHOQSA-N |
| XLogP | -0.42 |
| TPSA | 176.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.48 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|