C17H30IN3O4S — CID 110059989
1-[2-(furan-2-yl)ethyl]-3-(4-methylsulfonylbutan-2-yl)-2-(oxolan-3-ylmethyl)guanidine;hydroiodide (PubChem CID 110059989) has the molecular formula C17H30IN3O4S and a molecular weight of 499.42 g/mol. Its IUPAC name is 1-[2-(furan-2-yl)ethyl]-3-(4-methylsulfonylbutan-2-yl)-2-(oxolan-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(furan-2-yl)ethyl]-3-(4-methylsulfonylbutan-2-yl)-2-(oxolan-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110059989 |
| Molecular Formula | C17H30IN3O4S |
| Molecular Weight | 499.42 g/mol |
| Exact Mass | 499.10 |
| IUPAC Name | 1-[2-(furan-2-yl)ethyl]-3-(4-methylsulfonylbutan-2-yl)-2-(oxolan-3-ylmethyl)guanidine;hydroiodide |
| SMILES | CC(CCS(C)(=O)=O)N/C(=N/CC1CCOC1)NCCc1ccco1.I |
| InChI | InChI=1S/C17H29N3O4S.HI/c1-14(7-11-25(2,21)22)20-17(19-12-15-6-10-23-13-15)18-8-5-16-4-3-9-24-16;/h3-4,9,14-15H,5-8,10-13H2,1-2H3,(H2,18,19,20);1H |
| InChIKey | YOMBVUYGMVTKSA-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.42 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|