C35H39NO4 — CID 11006032
(2R,3R,4R,5S)-5-(benzylamino)-1,3,4-tris(phenylmethoxy)hept-6-en-2-ol (PubChem CID 11006032) has the molecular formula C35H39NO4 and a molecular weight of 537.70 g/mol. Its IUPAC name is (2R,3R,4R,5S)-5-(benzylamino)-1,3,4-tris(phenylmethoxy)hept-6-en-2-ol.
| Compound Name | (2R,3R,4R,5S)-5-(benzylamino)-1,3,4-tris(phenylmethoxy)hept-6-en-2-ol |
|---|---|
| PubChem CID | 11006032 |
| Molecular Formula | C35H39NO4 |
| Molecular Weight | 537.70 g/mol |
| Exact Mass | 537.29 |
| IUPAC Name | (2R,3R,4R,5S)-5-(benzylamino)-1,3,4-tris(phenylmethoxy)hept-6-en-2-ol |
| SMILES | C=C[C@H](NCc1ccccc1)[C@@H](OCc1ccccc1)[C@H](OCc1ccccc1)[C@H](O)COCc1ccccc1 |
| InChI | InChI=1S/C35H39NO4/c1-2-32(36-23-28-15-7-3-8-16-28)34(39-25-30-19-11-5-12-20-30)35(40-26-31-21-13-6-14-22-31)33(37)27-38-24-29-17-9-4-10-18-29/h2-22,32-37H,1,23-27H2/t32-,33+,34+,35+/m0/s1 |
| InChIKey | NEAQNLWNNHHMPI-FZCXESBVSA-N |
| XLogP | 6.08 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.70 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|