C26H48S2Sn — CID 11006072
tributyl-[(E)-3-[2-[(3E)-4-methylhexa-3,5-dienyl]-1,3-dithian-2-yl]prop-1-enyl]stannane (PubChem CID 11006072) has the molecular formula C26H48S2Sn and a molecular weight of 543.52 g/mol. Its IUPAC name is tributyl-[(E)-3-[2-[(3E)-4-methylhexa-3,5-dienyl]-1,3-dithian-2-yl]prop-1-enyl]stannane.
| Compound Name | tributyl-[(E)-3-[2-[(3E)-4-methylhexa-3,5-dienyl]-1,3-dithian-2-yl]prop-1-enyl]stannane |
|---|---|
| PubChem CID | 11006072 |
| Molecular Formula | C26H48S2Sn |
| Molecular Weight | 543.52 g/mol |
| Exact Mass | 544.22 |
| IUPAC Name | tributyl-[(E)-3-[2-[(3E)-4-methylhexa-3,5-dienyl]-1,3-dithian-2-yl]prop-1-enyl]stannane |
| SMILES | C=C/C(C)=C/CCC1(C/C=C/[Sn](CCCC)(CCCC)CCCC)SCCCS1 |
| InChI | InChI=1S/C14H21S2.3C4H9.Sn/c1-4-9-14(15-11-7-12-16-14)10-6-8-13(3)5-2;3*1-3-4-2;/h1,4-5,8H,2,6-7,9-12H2,3H3;3*1,3-4H2,2H3;/b4-1?,13-8+;;;; |
| InChIKey | GFEWXIZYQBNPQT-VFDRRGECSA-N |
| XLogP | 9.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.52 |
| LogP ≤ 5 | 9.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|