C28H24O8S2 — CID 11006163
2,12,19,29-tetraoxa-7λ6,24λ6-dithiatricyclo[28.4.0.013,18]tetratriaconta-1(34),13,15,17,30,32-hexaen-4,9,21,26-tetrayne 7,7,24,24-tetraoxide (PubChem CID 11006163) has the molecular formula C28H24O8S2 and a molecular weight of 552.63 g/mol. Its IUPAC name is 2,12,19,29-tetraoxa-7λ6,24λ6-dithiatricyclo[28.4.0.013,18]tetratriaconta-1(34),13,15,17,30,32-hexaen-4,9,21,26-tetrayne 7,7,24,24-tetraoxide.
| Compound Name | 2,12,19,29-tetraoxa-7λ6,24λ6-dithiatricyclo[28.4.0.013,18]tetratriaconta-1(34),13,15,17,30,32-hexaen-4,9,21,26-tetrayne 7,7,24,24-tetraoxide |
|---|---|
| PubChem CID | 11006163 |
| Molecular Formula | C28H24O8S2 |
| Molecular Weight | 552.63 g/mol |
| Exact Mass | 552.09 |
| IUPAC Name | 2,12,19,29-tetraoxa-7λ6,24λ6-dithiatricyclo[28.4.0.013,18]tetratriaconta-1(34),13,15,17,30,32-hexaen-4,9,21,26-tetrayne 7,7,24,24-tetraoxide |
| SMILES | O=S1(=O)CC#CCOc2ccccc2OCC#CCS(=O)(=O)CC#CCOc2ccccc2OCC#CC1 |
| InChI | InChI=1S/C28H24O8S2/c29-37(30)21-9-5-17-33-25-13-1-2-14-26(25)34-18-6-10-22-38(31,32)24-12-8-20-36-28-16-4-3-15-27(28)35-19-7-11-23-37/h1-4,13-16H,17-24H2 |
| InChIKey | IRZZGJFVNMPKQL-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.63 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|