About 5-[3-[iodo(diphenyl)stannyl]propyl]-2,2-dimethyl-1,3-dioxolan-4-one
5-[3-[iodo(diphenyl)stannyl]propyl]-2,2-dimethyl-1,3-dioxolan-4-one (PubChem CID 11006205) has the molecular formula C20H23IO3Sn
and a molecular weight of 557.02 g/mol. Its IUPAC name is 5-[3-[iodo(diphenyl)stannyl]propyl]-2,2-dimethyl-1,3-dioxolan-4-one.
Molecular Properties
| Compound Name | 5-[3-[iodo(diphenyl)stannyl]propyl]-2,2-dimethyl-1,3-dioxolan-4-one |
| PubChem CID | 11006205 |
| Molecular Formula | C20H23IO3Sn |
| Molecular Weight | 557.02 g/mol |
| Exact Mass | 557.97 |
| IUPAC Name | 5-[3-[iodo(diphenyl)stannyl]propyl]-2,2-dimethyl-1,3-dioxolan-4-one |
| SMILES | CC1(C)OC(=O)C(CCC[Sn](I)(c2ccccc2)c2ccccc2)O1 |
| InChI | InChI=1S/C8H13O3.2C6H5.HI.Sn/c1-4-5-6-7(9)11-8(2,3)10-6;2*1-2-4-6-5-3-1;;/h6H,1,4-5H2,2-3H3;2*1-5H;1H;/q;;;;+1/p-1 |
| InChIKey | XBYKIABVIMLWRD-UHFFFAOYSA-M |
| XLogP | 3.64 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 557.02 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-[3-[iodo(diphenyl)stannyl]propyl]-2,2-dimethyl-1,3-dioxolan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3-[iodo(diphenyl)stannyl]propyl]-2,2-dimethyl-1,3-dioxolan-4-one?
The IUPAC name of 5-[3-[iodo(diphenyl)stannyl]propyl]-2,2-dimethyl-1,3-dioxolan-4-one (CID 11006205) is 5-[3-[iodo(diphenyl)stannyl]propyl]-2,2-dimethyl-1,3-dioxolan-4-one.
What is the SMILES notation for 5-[3-[iodo(diphenyl)stannyl]propyl]-2,2-dimethyl-1,3-dioxolan-4-one?
The canonical SMILES for 5-[3-[iodo(diphenyl)stannyl]propyl]-2,2-dimethyl-1,3-dioxolan-4-one is CC1(C)OC(=O)C(CCC[Sn](I)(c2ccccc2)c2ccccc2)O1.
What is the InChIKey of 5-[3-[iodo(diphenyl)stannyl]propyl]-2,2-dimethyl-1,3-dioxolan-4-one?
The InChIKey is XBYKIABVIMLWRD-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H13O3.2C6H5.HI.Sn/c1-4-5-6-7(9)11-8(2,3)10-6;2*1-2-4-6-5-3-1;;/h6H,1,4-5H2,2-3H3;2*1-5H;1H;/q;;;;+1/p-1.
What are the key properties of 5-[3-[iodo(diphenyl)stannyl]propyl]-2,2-dimethyl-1,3-dioxolan-4-one?
5-[3-[iodo(diphenyl)stannyl]propyl]-2,2-dimethyl-1,3-dioxolan-4-one has a molecular weight of 557.02 g/mol, XLogP of 3.64, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3-[iodo(diphenyl)stannyl]propyl]-2,2-dimethyl-1,3-dioxolan-4-one is sourced from PubChem (CID 11006205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).