C26H33F3O6SSi — CID 11006216
[(1S)-1-[(2R,3aR,7aR)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyran-2-yl]-2-[tert-butyl(diphenyl)silyl]oxyethyl] trifluoromethanesulfonate (PubChem CID 11006216) has the molecular formula C26H33F3O6SSi and a molecular weight of 558.69 g/mol. Its IUPAC name is [(1S)-1-[(2R,3aR,7aR)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyran-2-yl]-2-[tert-butyl(diphenyl)silyl]oxyethyl] trifluoromethanesulfonate.
| Compound Name | [(1S)-1-[(2R,3aR,7aR)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyran-2-yl]-2-[tert-butyl(diphenyl)silyl]oxyethyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 11006216 |
| Molecular Formula | C26H33F3O6SSi |
| Molecular Weight | 558.69 g/mol |
| Exact Mass | 558.17 |
| IUPAC Name | [(1S)-1-[(2R,3aR,7aR)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyran-2-yl]-2-[tert-butyl(diphenyl)silyl]oxyethyl] trifluoromethanesulfonate |
| SMILES | CC(C)(C)[Si](OC[C@H](OS(=O)(=O)C(F)(F)F)[C@H]1C[C@H]2OCCC[C@H]2O1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H33F3O6SSi/c1-25(2,3)37(19-11-6-4-7-12-19,20-13-8-5-9-14-20)33-18-24(35-36(30,31)26(27,28)29)23-17-22-21(34-23)15-10-16-32-22/h4-9,11-14,21-24H,10,15-18H2,1-3H3/t21-,22-,23-,24+/m1/s1 |
| InChIKey | ADXJKUYUHZIBOC-YCAMKHIRSA-N |
| XLogP | 4.13 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.69 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|