C14H28N6 — CID 110062172
2-[6-[[amino-(cyclopropylamino)methylidene]amino]hexyl]-1-cyclopropylguanidine (PubChem CID 110062172) has the molecular formula C14H28N6 and a molecular weight of 280.42 g/mol. Its IUPAC name is 2-[6-[[amino-(cyclopropylamino)methylidene]amino]hexyl]-1-cyclopropylguanidine.
| Compound Name | 2-[6-[[amino-(cyclopropylamino)methylidene]amino]hexyl]-1-cyclopropylguanidine |
|---|---|
| PubChem CID | 110062172 |
| Molecular Formula | C14H28N6 |
| Molecular Weight | 280.42 g/mol |
| Exact Mass | 280.24 |
| IUPAC Name | 2-[6-[[amino-(cyclopropylamino)methylidene]amino]hexyl]-1-cyclopropylguanidine |
| SMILES | N/C(=N\CCCCCC/N=C(\N)NC1CC1)NC1CC1 |
| InChI | InChI=1S/C14H28N6/c15-13(19-11-5-6-11)17-9-3-1-2-4-10-18-14(16)20-12-7-8-12/h11-12H,1-10H2,(H3,15,17,19)(H3,16,18,20) |
| InChIKey | XTYPRLLFRJEGFL-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 100.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.42 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|