C18H33IN6 — CID 110062304
2-[[4-[[[amino-(butan-2-ylamino)methylidene]amino]methyl]phenyl]methyl]-1-butan-2-ylguanidine;hydroiodide (PubChem CID 110062304) has the molecular formula C18H33IN6 and a molecular weight of 460.41 g/mol. Its IUPAC name is 2-[[4-[[[amino-(butan-2-ylamino)methylidene]amino]methyl]phenyl]methyl]-1-butan-2-ylguanidine;hydroiodide.
| Compound Name | 2-[[4-[[[amino-(butan-2-ylamino)methylidene]amino]methyl]phenyl]methyl]-1-butan-2-ylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110062304 |
| Molecular Formula | C18H33IN6 |
| Molecular Weight | 460.41 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | 2-[[4-[[[amino-(butan-2-ylamino)methylidene]amino]methyl]phenyl]methyl]-1-butan-2-ylguanidine;hydroiodide |
| SMILES | CCC(C)N/C(N)=N/Cc1ccc(C/N=C(\N)NC(C)CC)cc1.I |
| InChI | InChI=1S/C18H32N6.HI/c1-5-13(3)23-17(19)21-11-15-7-9-16(10-8-15)12-22-18(20)24-14(4)6-2;/h7-10,13-14H,5-6,11-12H2,1-4H3,(H3,19,21,23)(H3,20,22,24);1H |
| InChIKey | BFPNZQGCPUBTGQ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 100.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.41 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|