C27H34ClN3O4 — CID 110062566
(4R,7S,10S)-4-benzyl-10-[(2S)-butan-2-yl]-16-chloro-7-propan-2-yl-2-oxa-5,8,11-triazabicyclo[11.4.0]heptadeca-1(13),14,16-triene-6,9,12-trione (PubChem CID 110062566) has the molecular formula C27H34ClN3O4 and a molecular weight of 500.04 g/mol. Its IUPAC name is (4R,7S,10S)-4-benzyl-10-[(2S)-butan-2-yl]-16-chloro-7-propan-2-yl-2-oxa-5,8,11-triazabicyclo[11.4.0]heptadeca-1(13),14,16-triene-6,9,12-trione.
| Compound Name | (4R,7S,10S)-4-benzyl-10-[(2S)-butan-2-yl]-16-chloro-7-propan-2-yl-2-oxa-5,8,11-triazabicyclo[11.4.0]heptadeca-1(13),14,16-triene-6,9,12-trione |
|---|---|
| PubChem CID | 110062566 |
| Molecular Formula | C27H34ClN3O4 |
| Molecular Weight | 500.04 g/mol |
| Exact Mass | 499.22 |
| IUPAC Name | (4R,7S,10S)-4-benzyl-10-[(2S)-butan-2-yl]-16-chloro-7-propan-2-yl-2-oxa-5,8,11-triazabicyclo[11.4.0]heptadeca-1(13),14,16-triene-6,9,12-trione |
| SMILES | CC[C@H](C)[C@@H]1NC(=O)c2ccc(Cl)cc2OC[C@@H](Cc2ccccc2)NC(=O)[C@H](C(C)C)NC1=O |
| InChI | InChI=1S/C27H34ClN3O4/c1-5-17(4)24-27(34)30-23(16(2)3)26(33)29-20(13-18-9-7-6-8-10-18)15-35-22-14-19(28)11-12-21(22)25(32)31-24/h6-12,14,16-17,20,23-24H,5,13,15H2,1-4H3,(H,29,33)(H,30,34)(H,31,32)/t17-,20+,23-,24-/m0/s1 |
| InChIKey | GDTYOIJHUDPJAG-UHVVYFEBSA-N |
| XLogP | 3.75 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.04 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |