C23H34ClN3O4 — CID 110062599
(7R,10R)-15-chloro-16-methyl-5,7,10-tri(propan-2-yl)-2-oxa-5,8,11-triazabicyclo[11.4.0]heptadeca-1(13),14,16-triene-6,9,12-trione (PubChem CID 110062599) has the molecular formula C23H34ClN3O4 and a molecular weight of 452.00 g/mol. Its IUPAC name is (7R,10R)-15-chloro-16-methyl-5,7,10-tri(propan-2-yl)-2-oxa-5,8,11-triazabicyclo[11.4.0]heptadeca-1(13),14,16-triene-6,9,12-trione.
| Compound Name | (7R,10R)-15-chloro-16-methyl-5,7,10-tri(propan-2-yl)-2-oxa-5,8,11-triazabicyclo[11.4.0]heptadeca-1(13),14,16-triene-6,9,12-trione |
|---|---|
| PubChem CID | 110062599 |
| Molecular Formula | C23H34ClN3O4 |
| Molecular Weight | 452.00 g/mol |
| Exact Mass | 451.22 |
| IUPAC Name | (7R,10R)-15-chloro-16-methyl-5,7,10-tri(propan-2-yl)-2-oxa-5,8,11-triazabicyclo[11.4.0]heptadeca-1(13),14,16-triene-6,9,12-trione |
| SMILES | Cc1cc2c(cc1Cl)C(=O)N[C@H](C(C)C)C(=O)NC(C(C)C)C(=O)N(C(C)C)CCO2 |
| InChI | InChI=1S/C23H34ClN3O4/c1-12(2)19-22(29)26-20(13(3)4)23(30)27(14(5)6)8-9-31-18-10-15(7)17(24)11-16(18)21(28)25-19/h10-14,19-20H,8-9H2,1-7H3,(H,25,28)(H,26,29)/t19-,20?/m1/s1 |
| InChIKey | WRKZRZKYCLMSKW-FIWHBWSRSA-N |
| XLogP | 3.17 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.00 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |