C34H44N4O4 — CID 110062608
2-[(1S,4R,9E,12R)-4-benzyl-3,6-dioxospiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-14-yl]-N-(2,6-dimethylphenyl)acetamide (PubChem CID 110062608) has the molecular formula C34H44N4O4 and a molecular weight of 572.75 g/mol. Its IUPAC name is 2-[(1S,4R,9E,12R)-4-benzyl-3,6-dioxospiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-14-yl]-N-(2,6-dimethylphenyl)acetamide.
| Compound Name | 2-[(1S,4R,9E,12R)-4-benzyl-3,6-dioxospiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-14-yl]-N-(2,6-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 110062608 |
| Molecular Formula | C34H44N4O4 |
| Molecular Weight | 572.75 g/mol |
| Exact Mass | 572.34 |
| IUPAC Name | 2-[(1S,4R,9E,12R)-4-benzyl-3,6-dioxospiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-14-yl]-N-(2,6-dimethylphenyl)acetamide |
| SMILES | Cc1cccc(C)c1NC(=O)CN1CC[C@@H]2NC(=O)[C@@H](Cc3ccccc3)NC(=O)C3(C/C=C/C[C@@H]2C1)CCOCC3 |
| InChI | InChI=1S/C34H44N4O4/c1-24-9-8-10-25(2)31(24)37-30(39)23-38-18-14-28-27(22-38)13-6-7-15-34(16-19-42-20-17-34)33(41)36-29(32(40)35-28)21-26-11-4-3-5-12-26/h3-12,27-29H,13-23H2,1-2H3,(H,35,40)(H,36,41)(H,37,39)/b7-6+/t27-,28+,29-/m1/s1 |
| InChIKey | QMIDPDSWJKXNSR-HBSRPKQBSA-N |
| XLogP | 3.92 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.75 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|