C27H30N4O3 — CID 110063241
(9E)-1'-(6-methylimidazo[1,2-a]pyridine-2-carbonyl)spiro[2-oxa-5-azabicyclo[10.4.0]hexadeca-1(16),9,12,14-tetraene-7,4'-piperidine]-4-one (PubChem CID 110063241) has the molecular formula C27H30N4O3 and a molecular weight of 458.56 g/mol. Its IUPAC name is (9E)-1'-(6-methylimidazo[1,2-a]pyridine-2-carbonyl)spiro[2-oxa-5-azabicyclo[10.4.0]hexadeca-1(16),9,12,14-tetraene-7,4'-piperidine]-4-one.
| Compound Name | (9E)-1'-(6-methylimidazo[1,2-a]pyridine-2-carbonyl)spiro[2-oxa-5-azabicyclo[10.4.0]hexadeca-1(16),9,12,14-tetraene-7,4'-piperidine]-4-one |
|---|---|
| PubChem CID | 110063241 |
| Molecular Formula | C27H30N4O3 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.23 |
| IUPAC Name | (9E)-1'-(6-methylimidazo[1,2-a]pyridine-2-carbonyl)spiro[2-oxa-5-azabicyclo[10.4.0]hexadeca-1(16),9,12,14-tetraene-7,4'-piperidine]-4-one |
| SMILES | Cc1ccc2nc(C(=O)N3CCC4(C/C=C/Cc5ccccc5OCC(=O)NC4)CC3)cn2c1 |
| InChI | InChI=1S/C27H30N4O3/c1-20-9-10-24-29-22(17-31(24)16-20)26(33)30-14-12-27(13-15-30)11-5-4-7-21-6-2-3-8-23(21)34-18-25(32)28-19-27/h2-6,8-10,16-17H,7,11-15,18-19H2,1H3,(H,28,32)/b5-4+ |
| InChIKey | AMDRLTVDIPIIME-SNAWJCMRSA-N |
| XLogP | 3.56 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|