C30H41N3O3 — CID 110063770
1-[10-[3-(3-pyrrolidin-1-ylpropoxy)benzoyl]-2,10-diazabicyclo[10.4.0]hexadeca-1(16),12,14-trien-2-yl]ethanone (PubChem CID 110063770) has the molecular formula C30H41N3O3 and a molecular weight of 491.68 g/mol. Its IUPAC name is 1-[10-[3-(3-pyrrolidin-1-ylpropoxy)benzoyl]-2,10-diazabicyclo[10.4.0]hexadeca-1(16),12,14-trien-2-yl]ethanone.
| Compound Name | 1-[10-[3-(3-pyrrolidin-1-ylpropoxy)benzoyl]-2,10-diazabicyclo[10.4.0]hexadeca-1(16),12,14-trien-2-yl]ethanone |
|---|---|
| PubChem CID | 110063770 |
| Molecular Formula | C30H41N3O3 |
| Molecular Weight | 491.68 g/mol |
| Exact Mass | 491.31 |
| IUPAC Name | 1-[10-[3-(3-pyrrolidin-1-ylpropoxy)benzoyl]-2,10-diazabicyclo[10.4.0]hexadeca-1(16),12,14-trien-2-yl]ethanone |
| SMILES | CC(=O)N1CCCCCCCN(C(=O)c2cccc(OCCCN3CCCC3)c2)Cc2ccccc21 |
| InChI | InChI=1S/C30H41N3O3/c1-25(34)33-21-8-4-2-3-7-20-32(24-27-13-5-6-16-29(27)33)30(35)26-14-11-15-28(23-26)36-22-12-19-31-17-9-10-18-31/h5-6,11,13-16,23H,2-4,7-10,12,17-22,24H2,1H3 |
| InChIKey | GGFABCASZHDFPD-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.68 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|